C19H15FN6 — CID 168893274
4-(4-fluorophenyl)-2-imino-5-quinolin-6-ylpyrimidine-1,6-diamine (PubChem CID 168893274) has the molecular formula C19H15FN6 and a molecular weight of 346.37 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-imino-5-quinolin-6-ylpyrimidine-1,6-diamine.
| Compound Name | 4-(4-fluorophenyl)-2-imino-5-quinolin-6-ylpyrimidine-1,6-diamine |
|---|---|
| PubChem CID | 168893274 |
| Molecular Formula | C19H15FN6 |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 4-(4-fluorophenyl)-2-imino-5-quinolin-6-ylpyrimidine-1,6-diamine |
| SMILES | [H]/N=c1\nc(-c2ccc(F)cc2)c(-c2ccc3ncccc3c2)c(N)n1N |
| InChI | InChI=1S/C19H15FN6/c20-14-6-3-11(4-7-14)17-16(18(21)26(23)19(22)25-17)13-5-8-15-12(10-13)2-1-9-24-15/h1-10,22H,21,23H2/b22-19+ |
| InChIKey | KQFIBLIXCNUFDM-ZBJSNUHESA-N |
| XLogP | 2.68 |
| TPSA | 106.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |