C19H12F3N3 — CID 122510407
6-[2-methyl-4-(3,4,5-trifluorophenyl)-1H-imidazol-5-yl]quinoline (PubChem CID 122510407) has the molecular formula C19H12F3N3 and a molecular weight of 339.32 g/mol. Its IUPAC name is 6-[2-methyl-4-(3,4,5-trifluorophenyl)-1H-imidazol-5-yl]quinoline.
| Compound Name | 6-[2-methyl-4-(3,4,5-trifluorophenyl)-1H-imidazol-5-yl]quinoline |
|---|---|
| PubChem CID | 122510407 |
| Molecular Formula | C19H12F3N3 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 6-[2-methyl-4-(3,4,5-trifluorophenyl)-1H-imidazol-5-yl]quinoline |
| SMILES | Cc1nc(-c2cc(F)c(F)c(F)c2)c(-c2ccc3ncccc3c2)[nH]1 |
| InChI | InChI=1S/C19H12F3N3/c1-10-24-18(12-4-5-16-11(7-12)3-2-6-23-16)19(25-10)13-8-14(20)17(22)15(21)9-13/h2-9H,1H3,(H,24,25) |
| InChIKey | NSRYFRPHASLGHF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|