C21H18FN3 — CID 122510804
6-[2-ethyl-4-(4-fluoro-3-methylphenyl)-1H-imidazol-5-yl]quinoline (PubChem CID 122510804) has the molecular formula C21H18FN3 and a molecular weight of 331.39 g/mol. Its IUPAC name is 6-[2-ethyl-4-(4-fluoro-3-methylphenyl)-1H-imidazol-5-yl]quinoline.
| Compound Name | 6-[2-ethyl-4-(4-fluoro-3-methylphenyl)-1H-imidazol-5-yl]quinoline |
|---|---|
| PubChem CID | 122510804 |
| Molecular Formula | C21H18FN3 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 6-[2-ethyl-4-(4-fluoro-3-methylphenyl)-1H-imidazol-5-yl]quinoline |
| SMILES | CCc1nc(-c2ccc(F)c(C)c2)c(-c2ccc3ncccc3c2)[nH]1 |
| InChI | InChI=1S/C21H18FN3/c1-3-19-24-20(15-6-8-17(22)13(2)11-15)21(25-19)16-7-9-18-14(12-16)5-4-10-23-18/h4-12H,3H2,1-2H3,(H,24,25) |
| InChIKey | LIKBZTZESCKFFS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |