C13H12N4 — CID 62875217
6-(5-ethyl-1H-1,2,4-triazol-3-yl)quinoline (PubChem CID 62875217) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 6-(5-ethyl-1H-1,2,4-triazol-3-yl)quinoline.
| Compound Name | 6-(5-ethyl-1H-1,2,4-triazol-3-yl)quinoline |
|---|---|
| PubChem CID | 62875217 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 6-(5-ethyl-1H-1,2,4-triazol-3-yl)quinoline |
| SMILES | CCc1nc(-c2ccc3ncccc3c2)n[nH]1 |
| InChI | InChI=1S/C13H12N4/c1-2-12-15-13(17-16-12)10-5-6-11-9(8-10)4-3-7-14-11/h3-8H,2H2,1H3,(H,15,16,17) |
| InChIKey | KUMVWPGTWDMBCZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |