C32H20N6 — CID 122427591
6-[4-(4-pyridin-2-ylphenyl)-6-quinolin-6-yl-1,3,5-triazin-2-yl]quinoline (PubChem CID 122427591) has the molecular formula C32H20N6 and a molecular weight of 488.55 g/mol. Its IUPAC name is 6-[4-(4-pyridin-2-ylphenyl)-6-quinolin-6-yl-1,3,5-triazin-2-yl]quinoline.
| Compound Name | 6-[4-(4-pyridin-2-ylphenyl)-6-quinolin-6-yl-1,3,5-triazin-2-yl]quinoline |
|---|---|
| PubChem CID | 122427591 |
| Molecular Formula | C32H20N6 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 6-[4-(4-pyridin-2-ylphenyl)-6-quinolin-6-yl-1,3,5-triazin-2-yl]quinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc5ncccc5c4)nc(-c4ccc5ncccc5c4)n3)cc2)nc1 |
| InChI | InChI=1S/C32H20N6/c1-2-16-33-27(7-1)21-8-10-22(11-9-21)30-36-31(25-12-14-28-23(19-25)5-3-17-34-28)38-32(37-30)26-13-15-29-24(20-26)6-4-18-35-29/h1-20H |
| InChIKey | UKCQTICAASNSLG-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |