C16H13Cl2N3 — CID 63611491
6-(4,6-dichloro-5-propylpyrimidin-2-yl)quinoline (PubChem CID 63611491) has the molecular formula C16H13Cl2N3 and a molecular weight of 318.21 g/mol. Its IUPAC name is 6-(4,6-dichloro-5-propylpyrimidin-2-yl)quinoline.
| Compound Name | 6-(4,6-dichloro-5-propylpyrimidin-2-yl)quinoline |
|---|---|
| PubChem CID | 63611491 |
| Molecular Formula | C16H13Cl2N3 |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 6-(4,6-dichloro-5-propylpyrimidin-2-yl)quinoline |
| SMILES | CCCc1c(Cl)nc(-c2ccc3ncccc3c2)nc1Cl |
| InChI | InChI=1S/C16H13Cl2N3/c1-2-4-12-14(17)20-16(21-15(12)18)11-6-7-13-10(9-11)5-3-8-19-13/h3,5-9H,2,4H2,1H3 |
| InChIKey | GIPATPFGAAHBCZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |