C13H10Cl4N2 — CID 63613499
4,6-dichloro-2-(2,6-dichlorophenyl)-5-propylpyrimidine (PubChem CID 63613499) has the molecular formula C13H10Cl4N2 and a molecular weight of 336.05 g/mol. Its IUPAC name is 4,6-dichloro-2-(2,6-dichlorophenyl)-5-propylpyrimidine.
| Compound Name | 4,6-dichloro-2-(2,6-dichlorophenyl)-5-propylpyrimidine |
|---|---|
| PubChem CID | 63613499 |
| Molecular Formula | C13H10Cl4N2 |
| Molecular Weight | 336.05 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 4,6-dichloro-2-(2,6-dichlorophenyl)-5-propylpyrimidine |
| SMILES | CCCc1c(Cl)nc(-c2c(Cl)cccc2Cl)nc1Cl |
| InChI | InChI=1S/C13H10Cl4N2/c1-2-4-7-11(16)18-13(19-12(7)17)10-8(14)5-3-6-9(10)15/h3,5-6H,2,4H2,1H3 |
| InChIKey | FRDKPXPGPVZUOM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.05 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |