C15H16Cl2N2S — CID 106847790
4,6-dichloro-2-(4-ethylsulfanylphenyl)-5-propylpyrimidine (PubChem CID 106847790) has the molecular formula C15H16Cl2N2S and a molecular weight of 327.28 g/mol. Its IUPAC name is 4,6-dichloro-2-(4-ethylsulfanylphenyl)-5-propylpyrimidine.
| Compound Name | 4,6-dichloro-2-(4-ethylsulfanylphenyl)-5-propylpyrimidine |
|---|---|
| PubChem CID | 106847790 |
| Molecular Formula | C15H16Cl2N2S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4,6-dichloro-2-(4-ethylsulfanylphenyl)-5-propylpyrimidine |
| SMILES | CCCc1c(Cl)nc(-c2ccc(SCC)cc2)nc1Cl |
| InChI | InChI=1S/C15H16Cl2N2S/c1-3-5-12-13(16)18-15(19-14(12)17)10-6-8-11(9-7-10)20-4-2/h6-9H,3-5H2,1-2H3 |
| InChIKey | AAHFOAPVYXOPDQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |