C10H9ClN2OS — CID 106849376
5-chloro-3-(4-ethylsulfanylphenyl)-1,2,4-oxadiazole (PubChem CID 106849376) has the molecular formula C10H9ClN2OS and a molecular weight of 240.72 g/mol. Its IUPAC name is 5-chloro-3-(4-ethylsulfanylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-chloro-3-(4-ethylsulfanylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 106849376 |
| Molecular Formula | C10H9ClN2OS |
| Molecular Weight | 240.72 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 5-chloro-3-(4-ethylsulfanylphenyl)-1,2,4-oxadiazole |
| SMILES | CCSc1ccc(-c2noc(Cl)n2)cc1 |
| InChI | InChI=1S/C10H9ClN2OS/c1-2-15-8-5-3-7(4-6-8)9-12-10(11)14-13-9/h3-6H,2H2,1H3 |
| InChIKey | FRYFGMQWQOICPX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |