C14H16N2O2S2 — CID 106850005
4-[3-(4-ethylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol (PubChem CID 106850005) has the molecular formula C14H16N2O2S2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 4-[3-(4-ethylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol.
| Compound Name | 4-[3-(4-ethylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
|---|---|
| PubChem CID | 106850005 |
| Molecular Formula | C14H16N2O2S2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 4-[3-(4-ethylsulfanylphenyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
| SMILES | CCSc1ccc(-c2noc(C3CSCC3O)n2)cc1 |
| InChI | InChI=1S/C14H16N2O2S2/c1-2-20-10-5-3-9(4-6-10)13-15-14(18-16-13)11-7-19-8-12(11)17/h3-6,11-12,17H,2,7-8H2,1H3 |
| InChIKey | TVLDOGSDLMQSFM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |