C12H10BrClN2O2S — CID 83200794
4-[3-(3-bromo-4-chlorophenyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol (PubChem CID 83200794) has the molecular formula C12H10BrClN2O2S and a molecular weight of 361.65 g/mol. Its IUPAC name is 4-[3-(3-bromo-4-chlorophenyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol.
| Compound Name | 4-[3-(3-bromo-4-chlorophenyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
|---|---|
| PubChem CID | 83200794 |
| Molecular Formula | C12H10BrClN2O2S |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 359.93 |
| IUPAC Name | 4-[3-(3-bromo-4-chlorophenyl)-1,2,4-oxadiazol-5-yl]thiolan-3-ol |
| SMILES | OC1CSCC1c1nc(-c2ccc(Cl)c(Br)c2)no1 |
| InChI | InChI=1S/C12H10BrClN2O2S/c13-8-3-6(1-2-9(8)14)11-15-12(18-16-11)7-4-19-5-10(7)17/h1-3,7,10,17H,4-5H2 |
| InChIKey | HCLHZOIIALWTCX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |