C16H14N2O2S — CID 83191804
4-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-ol (PubChem CID 83191804) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 4-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-ol.
| Compound Name | 4-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-ol |
|---|---|
| PubChem CID | 83191804 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-(3-naphthalen-2-yl-1,2,4-oxadiazol-5-yl)thiolan-3-ol |
| SMILES | OC1CSCC1c1nc(-c2ccc3ccccc3c2)no1 |
| InChI | InChI=1S/C16H14N2O2S/c19-14-9-21-8-13(14)16-17-15(18-20-16)12-6-5-10-3-1-2-4-11(10)7-12/h1-7,13-14,19H,8-9H2 |
| InChIKey | WMNCVJGDLFASNS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |