C14H13BrCl2N2 — CID 103083580
2-(4-bromo-2-methylphenyl)-4,6-dichloro-5-propylpyrimidine (PubChem CID 103083580) has the molecular formula C14H13BrCl2N2 and a molecular weight of 360.08 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)-4,6-dichloro-5-propylpyrimidine.
| Compound Name | 2-(4-bromo-2-methylphenyl)-4,6-dichloro-5-propylpyrimidine |
|---|---|
| PubChem CID | 103083580 |
| Molecular Formula | C14H13BrCl2N2 |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)-4,6-dichloro-5-propylpyrimidine |
| SMILES | CCCc1c(Cl)nc(-c2ccc(Br)cc2C)nc1Cl |
| InChI | InChI=1S/C14H13BrCl2N2/c1-3-4-11-12(16)18-14(19-13(11)17)10-6-5-9(15)7-8(10)2/h5-7H,3-4H2,1-2H3 |
| InChIKey | HTJUKFGWGSIHTI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |