C14H15Br2N3 — CID 103083781
5-bromo-2-(4-bromo-2-methylphenyl)-N-ethyl-6-methylpyrimidin-4-amine (PubChem CID 103083781) has the molecular formula C14H15Br2N3 and a molecular weight of 385.10 g/mol. Its IUPAC name is 5-bromo-2-(4-bromo-2-methylphenyl)-N-ethyl-6-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(4-bromo-2-methylphenyl)-N-ethyl-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103083781 |
| Molecular Formula | C14H15Br2N3 |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 5-bromo-2-(4-bromo-2-methylphenyl)-N-ethyl-6-methylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ccc(Br)cc2C)nc(C)c1Br |
| InChI | InChI=1S/C14H15Br2N3/c1-4-17-14-12(16)9(3)18-13(19-14)11-6-5-10(15)7-8(11)2/h5-7H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | KDDPRXMPZZODGD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |