C15H17Br2N3 — CID 103083799
5-bromo-2-(4-bromo-2-methylphenyl)-N,6-diethylpyrimidin-4-amine (PubChem CID 103083799) has the molecular formula C15H17Br2N3 and a molecular weight of 399.13 g/mol. Its IUPAC name is 5-bromo-2-(4-bromo-2-methylphenyl)-N,6-diethylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(4-bromo-2-methylphenyl)-N,6-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103083799 |
| Molecular Formula | C15H17Br2N3 |
| Molecular Weight | 399.13 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 5-bromo-2-(4-bromo-2-methylphenyl)-N,6-diethylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2ccc(Br)cc2C)nc(CC)c1Br |
| InChI | InChI=1S/C15H17Br2N3/c1-4-12-13(17)15(18-5-2)20-14(19-12)11-7-6-10(16)8-9(11)3/h6-8H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | RMTBUDQPKDJTHF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.13 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |