C14H15BrFN3 — CID 66299647
5-bromo-N,6-diethyl-2-(3-fluorophenyl)pyrimidin-4-amine (PubChem CID 66299647) has the molecular formula C14H15BrFN3 and a molecular weight of 324.20 g/mol. Its IUPAC name is 5-bromo-N,6-diethyl-2-(3-fluorophenyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-N,6-diethyl-2-(3-fluorophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 66299647 |
| Molecular Formula | C14H15BrFN3 |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 5-bromo-N,6-diethyl-2-(3-fluorophenyl)pyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cccc(F)c2)nc(CC)c1Br |
| InChI | InChI=1S/C14H15BrFN3/c1-3-11-12(15)14(17-4-2)19-13(18-11)9-6-5-7-10(16)8-9/h5-8H,3-4H2,1-2H3,(H,17,18,19) |
| InChIKey | GPDZPJBMPLATRR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |