C16H20BrN3 — CID 66295796
5-bromo-2-(3,5-dimethylphenyl)-N,6-diethylpyrimidin-4-amine (PubChem CID 66295796) has the molecular formula C16H20BrN3 and a molecular weight of 334.26 g/mol. Its IUPAC name is 5-bromo-2-(3,5-dimethylphenyl)-N,6-diethylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(3,5-dimethylphenyl)-N,6-diethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66295796 |
| Molecular Formula | C16H20BrN3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 5-bromo-2-(3,5-dimethylphenyl)-N,6-diethylpyrimidin-4-amine |
| SMILES | CCNc1nc(-c2cc(C)cc(C)c2)nc(CC)c1Br |
| InChI | InChI=1S/C16H20BrN3/c1-5-13-14(17)16(18-6-2)20-15(19-13)12-8-10(3)7-11(4)9-12/h7-9H,5-6H2,1-4H3,(H,18,19,20) |
| InChIKey | HXRJNGGTPCREDC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |