C9H7BrClN3 — CID 103084158
3-(4-bromo-2-methylphenyl)-5-chloro-1H-1,2,4-triazole (PubChem CID 103084158) has the molecular formula C9H7BrClN3 and a molecular weight of 272.53 g/mol. Its IUPAC name is 3-(4-bromo-2-methylphenyl)-5-chloro-1H-1,2,4-triazole.
| Compound Name | 3-(4-bromo-2-methylphenyl)-5-chloro-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 103084158 |
| Molecular Formula | C9H7BrClN3 |
| Molecular Weight | 272.53 g/mol |
| Exact Mass | 270.95 |
| IUPAC Name | 3-(4-bromo-2-methylphenyl)-5-chloro-1H-1,2,4-triazole |
| SMILES | Cc1cc(Br)ccc1-c1n[nH]c(Cl)n1 |
| InChI | InChI=1S/C9H7BrClN3/c1-5-4-6(10)2-3-7(5)8-12-9(11)14-13-8/h2-4H,1H3,(H,12,13,14) |
| InChIKey | OFSACVZPKOITIH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |