C9H9BrN4 — CID 61279545
5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 61279545) has the molecular formula C9H9BrN4 and a molecular weight of 253.10 g/mol. Its IUPAC name is 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 61279545 |
| Molecular Formula | C9H9BrN4 |
| Molecular Weight | 253.10 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1nc(-c2ccc(Br)cc2N)n[nH]1 |
| InChI | InChI=1S/C9H9BrN4/c1-5-12-9(14-13-5)7-3-2-6(10)4-8(7)11/h2-4H,11H2,1H3,(H,12,13,14) |
| InChIKey | NWRUONNOEKMTRU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.10 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|