C14H11ClN4O — CID 81221812
6-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)quinoline (PubChem CID 81221812) has the molecular formula C14H11ClN4O and a molecular weight of 286.72 g/mol. Its IUPAC name is 6-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)quinoline.
| Compound Name | 6-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)quinoline |
|---|---|
| PubChem CID | 81221812 |
| Molecular Formula | C14H11ClN4O |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 6-(4-chloro-6-ethoxy-1,3,5-triazin-2-yl)quinoline |
| SMILES | CCOc1nc(Cl)nc(-c2ccc3ncccc3c2)n1 |
| InChI | InChI=1S/C14H11ClN4O/c1-2-20-14-18-12(17-13(15)19-14)10-5-6-11-9(8-10)4-3-7-16-11/h3-8H,2H2,1H3 |
| InChIKey | HOEKAIMDPHZOGU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |