C11H7ClF3N3O — CID 113324560
2-chloro-4-ethoxy-6-(2,4,5-trifluorophenyl)-1,3,5-triazine (PubChem CID 113324560) has the molecular formula C11H7ClF3N3O and a molecular weight of 289.64 g/mol. Its IUPAC name is 2-chloro-4-ethoxy-6-(2,4,5-trifluorophenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-ethoxy-6-(2,4,5-trifluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 113324560 |
| Molecular Formula | C11H7ClF3N3O |
| Molecular Weight | 289.64 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-chloro-4-ethoxy-6-(2,4,5-trifluorophenyl)-1,3,5-triazine |
| SMILES | CCOc1nc(Cl)nc(-c2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C11H7ClF3N3O/c1-2-19-11-17-9(16-10(12)18-11)5-3-7(14)8(15)4-6(5)13/h3-4H,2H2,1H3 |
| InChIKey | GWJNZVNFDKACNB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|