C10H8ClFN4O — CID 104739155
2-chloro-4-ethoxy-6-(3-fluoro-4-pyridinyl)-1,3,5-triazine (PubChem CID 104739155) has the molecular formula C10H8ClFN4O and a molecular weight of 254.65 g/mol. Its IUPAC name is 2-chloro-4-ethoxy-6-(3-fluoro-4-pyridinyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-ethoxy-6-(3-fluoro-4-pyridinyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 104739155 |
| Molecular Formula | C10H8ClFN4O |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-chloro-4-ethoxy-6-(3-fluoro-4-pyridinyl)-1,3,5-triazine |
| SMILES | CCOc1nc(Cl)nc(-c2ccncc2F)n1 |
| InChI | InChI=1S/C10H8ClFN4O/c1-2-17-10-15-8(14-9(11)16-10)6-3-4-13-5-7(6)12/h3-5H,2H2,1H3 |
| InChIKey | KYJORWYMNJHTFG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |