C10H5ClF3N3O — CID 115503226
2-chloro-4-methoxy-6-(2,4,5-trifluorophenyl)-1,3,5-triazine (PubChem CID 115503226) has the molecular formula C10H5ClF3N3O and a molecular weight of 275.62 g/mol. Its IUPAC name is 2-chloro-4-methoxy-6-(2,4,5-trifluorophenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4-methoxy-6-(2,4,5-trifluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 115503226 |
| Molecular Formula | C10H5ClF3N3O |
| Molecular Weight | 275.62 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 2-chloro-4-methoxy-6-(2,4,5-trifluorophenyl)-1,3,5-triazine |
| SMILES | COc1nc(Cl)nc(-c2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C10H5ClF3N3O/c1-18-10-16-8(15-9(11)17-10)4-2-6(13)7(14)3-5(4)12/h2-3H,1H3 |
| InChIKey | FAYFQNSFYGYVOS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.62 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|