C12H10N4 — CID 62875043
6-(5-methyl-1H-1,2,4-triazol-3-yl)quinoline (PubChem CID 62875043) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 6-(5-methyl-1H-1,2,4-triazol-3-yl)quinoline.
| Compound Name | 6-(5-methyl-1H-1,2,4-triazol-3-yl)quinoline |
|---|---|
| PubChem CID | 62875043 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 6-(5-methyl-1H-1,2,4-triazol-3-yl)quinoline |
| SMILES | Cc1nc(-c2ccc3ncccc3c2)n[nH]1 |
| InChI | InChI=1S/C12H10N4/c1-8-14-12(16-15-8)10-4-5-11-9(7-10)3-2-6-13-11/h2-7H,1H3,(H,14,15,16) |
| InChIKey | PHNZSRRAPLYSCT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |