C10H10ClN3 — CID 46398001
3-(3-chlorophenyl)-5-ethyl-1H-1,2,4-triazole (PubChem CID 46398001) has the molecular formula C10H10ClN3 and a molecular weight of 207.66 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-ethyl-1H-1,2,4-triazole.
| Compound Name | 3-(3-chlorophenyl)-5-ethyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 46398001 |
| Molecular Formula | C10H10ClN3 |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 3-(3-chlorophenyl)-5-ethyl-1H-1,2,4-triazole |
| SMILES | CCc1nc(-c2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C10H10ClN3/c1-2-9-12-10(14-13-9)7-4-3-5-8(11)6-7/h3-6H,2H2,1H3,(H,12,13,14) |
| InChIKey | GIEPTGNPUWLGDG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |