C15H13ClN4 — CID 61353986
3-chloro-N-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]aniline (PubChem CID 61353986) has the molecular formula C15H13ClN4 and a molecular weight of 284.75 g/mol. Its IUPAC name is 3-chloro-N-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]aniline.
| Compound Name | 3-chloro-N-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 61353986 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-chloro-N-[(3-phenyl-1H-1,2,4-triazol-5-yl)methyl]aniline |
| SMILES | Clc1cccc(NCc2nc(-c3ccccc3)n[nH]2)c1 |
| InChI | InChI=1S/C15H13ClN4/c16-12-7-4-8-13(9-12)17-10-14-18-15(20-19-14)11-5-2-1-3-6-11/h1-9,17H,10H2,(H,18,19,20) |
| InChIKey | HLYFMZRNCPXMKN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |