C17H18N4O2 — CID 43840001
4-methoxy-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]aniline (PubChem CID 43840001) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 4-methoxy-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]aniline.
| Compound Name | 4-methoxy-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 43840001 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 4-methoxy-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]aniline |
| SMILES | COc1ccc(NCc2nc(-c3ccc(OC)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H18N4O2/c1-22-14-7-3-12(4-8-14)17-19-16(20-21-17)11-18-13-5-9-15(23-2)10-6-13/h3-10,18H,11H2,1-2H3,(H,19,20,21) |
| InChIKey | UJBVOCCAVLIIRJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|