C11H13ClN4 — CID 61277734
3-chloro-N-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]aniline (PubChem CID 61277734) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 3-chloro-N-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]aniline.
| Compound Name | 3-chloro-N-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 61277734 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-chloro-N-[(3-ethyl-1H-1,2,4-triazol-5-yl)methyl]aniline |
| SMILES | CCc1n[nH]c(CNc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C11H13ClN4/c1-2-10-14-11(16-15-10)7-13-9-5-3-4-8(12)6-9/h3-6,13H,2,7H2,1H3,(H,14,15,16) |
| InChIKey | FGZGDVJQLZVMDO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |