C15H13ClN4 — CID 66487206
5-[3-(3-chlorophenyl)-1H-1,2,4-triazol-5-yl]-2-methylaniline (PubChem CID 66487206) has the molecular formula C15H13ClN4 and a molecular weight of 284.75 g/mol. Its IUPAC name is 5-[3-(3-chlorophenyl)-1H-1,2,4-triazol-5-yl]-2-methylaniline.
| Compound Name | 5-[3-(3-chlorophenyl)-1H-1,2,4-triazol-5-yl]-2-methylaniline |
|---|---|
| PubChem CID | 66487206 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-[3-(3-chlorophenyl)-1H-1,2,4-triazol-5-yl]-2-methylaniline |
| SMILES | Cc1ccc(-c2nc(-c3cccc(Cl)c3)n[nH]2)cc1N |
| InChI | InChI=1S/C15H13ClN4/c1-9-5-6-11(8-13(9)17)15-18-14(19-20-15)10-3-2-4-12(16)7-10/h2-8H,17H2,1H3,(H,18,19,20) |
| InChIKey | SEBXGTNRLSWPQF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|