C15H11F3N4 — CID 82569359
2-methyl-5-[5-(2,3,4-trifluorophenyl)-1H-1,2,4-triazol-3-yl]aniline (PubChem CID 82569359) has the molecular formula C15H11F3N4 and a molecular weight of 304.28 g/mol. Its IUPAC name is 2-methyl-5-[5-(2,3,4-trifluorophenyl)-1H-1,2,4-triazol-3-yl]aniline.
| Compound Name | 2-methyl-5-[5-(2,3,4-trifluorophenyl)-1H-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 82569359 |
| Molecular Formula | C15H11F3N4 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-methyl-5-[5-(2,3,4-trifluorophenyl)-1H-1,2,4-triazol-3-yl]aniline |
| SMILES | Cc1ccc(-c2n[nH]c(-c3ccc(F)c(F)c3F)n2)cc1N |
| InChI | InChI=1S/C15H11F3N4/c1-7-2-3-8(6-11(7)19)14-20-15(22-21-14)9-4-5-10(16)13(18)12(9)17/h2-6H,19H2,1H3,(H,20,21,22) |
| InChIKey | HPNXEZLSQGWSIN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|