C14H13N5 — CID 66487123
2-methyl-4-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 66487123) has the molecular formula C14H13N5 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-methyl-4-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | 2-methyl-4-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 66487123 |
| Molecular Formula | C14H13N5 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 2-methyl-4-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1cc(-c2n[nH]c(-c3ccncc3)n2)ccc1N |
| InChI | InChI=1S/C14H13N5/c1-9-8-11(2-3-12(9)15)14-17-13(18-19-14)10-4-6-16-7-5-10/h2-8H,15H2,1H3,(H,17,18,19) |
| InChIKey | LBKSKRIKPWOXKM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|