C12H16N4 — CID 61339107
2-methyl-4-(5-propyl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 61339107) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-methyl-4-(5-propyl-1H-1,2,4-triazol-3-yl)aniline.
| Compound Name | 2-methyl-4-(5-propyl-1H-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 61339107 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-methyl-4-(5-propyl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | CCCc1nc(-c2ccc(N)c(C)c2)n[nH]1 |
| InChI | InChI=1S/C12H16N4/c1-3-4-11-14-12(16-15-11)9-5-6-10(13)8(2)7-9/h5-7H,3-4,13H2,1-2H3,(H,14,15,16) |
| InChIKey | LACSVFBJIWUYQF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|