C15H20N4 — CID 61337782
5-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2-methylaniline (PubChem CID 61337782) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is 5-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2-methylaniline.
| Compound Name | 5-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2-methylaniline |
|---|---|
| PubChem CID | 61337782 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 5-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)-2-methylaniline |
| SMILES | Cc1ccc(-c2n[nH]c(C3CCCCC3)n2)cc1N |
| InChI | InChI=1S/C15H20N4/c1-10-7-8-12(9-13(10)16)15-17-14(18-19-15)11-5-3-2-4-6-11/h7-9,11H,2-6,16H2,1H3,(H,17,18,19) |
| InChIKey | SANNZUTVKXRQNB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|