About 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole
6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole (PubChem CID 122510760) has the molecular formula C18H14F2N4
and a molecular weight of 324.33 g/mol. Its IUPAC name is 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole.
Molecular Properties
| Compound Name | 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole |
| PubChem CID | 122510760 |
| Molecular Formula | C18H14F2N4 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole |
| SMILES | CCc1nc(-c2ccc(F)c(F)c2)c(-c2ccc3cn[nH]c3c2)[nH]1 |
| InChI | InChI=1S/C18H14F2N4/c1-2-16-22-17(10-5-6-13(19)14(20)7-10)18(23-16)11-3-4-12-9-21-24-15(12)8-11/h3-9H,2H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | OMUULXNVEBKCHL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole?
The IUPAC name of 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole (CID 122510760) is 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole.
What is the SMILES notation for 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole?
The canonical SMILES for 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole is CCc1nc(-c2ccc(F)c(F)c2)c(-c2ccc3cn[nH]c3c2)[nH]1.
What is the InChIKey of 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole?
The InChIKey is OMUULXNVEBKCHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14F2N4/c1-2-16-22-17(10-5-6-13(19)14(20)7-10)18(23-16)11-3-4-12-9-21-24-15(12)8-11/h3-9H,2H2,1H3,(H,21,24)(H,22,23).
What are the key properties of 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole?
6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole has a molecular weight of 324.33 g/mol, XLogP of 4.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(3,4-difluorophenyl)-2-ethyl-1H-imidazol-5-yl]-1H-indazole is sourced from PubChem (CID 122510760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).