C16H12F4N2O — CID 141354844
6-[5-fluoro-4-methoxy-2-(2,2,2-trifluoroethyl)phenyl]-1H-indazole (PubChem CID 141354844) has the molecular formula C16H12F4N2O and a molecular weight of 324.28 g/mol. Its IUPAC name is 6-[5-fluoro-4-methoxy-2-(2,2,2-trifluoroethyl)phenyl]-1H-indazole.
| Compound Name | 6-[5-fluoro-4-methoxy-2-(2,2,2-trifluoroethyl)phenyl]-1H-indazole |
|---|---|
| PubChem CID | 141354844 |
| Molecular Formula | C16H12F4N2O |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 6-[5-fluoro-4-methoxy-2-(2,2,2-trifluoroethyl)phenyl]-1H-indazole |
| SMILES | COc1cc(CC(F)(F)F)c(-c2ccc3cn[nH]c3c2)cc1F |
| InChI | InChI=1S/C16H12F4N2O/c1-23-15-5-11(7-16(18,19)20)12(6-13(15)17)9-2-3-10-8-21-22-14(10)4-9/h2-6,8H,7H2,1H3,(H,21,22) |
| InChIKey | JDESCGIBHGRGLO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |