C13H12F3N3O — CID 171644919
1-[[5-(2,2,2-trifluoroethyl)-1H-indazol-6-yl]oxy]but-3-en-2-imine (PubChem CID 171644919) has the molecular formula C13H12F3N3O and a molecular weight of 283.25 g/mol. Its IUPAC name is 1-[[5-(2,2,2-trifluoroethyl)-1H-indazol-6-yl]oxy]but-3-en-2-imine.
| Compound Name | 1-[[5-(2,2,2-trifluoroethyl)-1H-indazol-6-yl]oxy]but-3-en-2-imine |
|---|---|
| PubChem CID | 171644919 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-[[5-(2,2,2-trifluoroethyl)-1H-indazol-6-yl]oxy]but-3-en-2-imine |
| SMILES | [H]/N=C(\C=C)COc1cc2[nH]ncc2cc1CC(F)(F)F |
| InChI | InChI=1S/C13H12F3N3O/c1-2-10(17)7-20-12-4-11-9(6-18-19-11)3-8(12)5-13(14,15)16/h2-4,6,17H,1,5,7H2,(H,18,19)/b17-10+ |
| InChIKey | ZMBLUCUBVLHLOK-LICLKQGHSA-N |
| XLogP | 3.25 |
| TPSA | 61.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|