C22H16ClF3N4O2 — CID 89401715
2-(5-chloro-2-methoxyphenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-(trifluoromethyl)benzenecarboximidamide (PubChem CID 89401715) has the molecular formula C22H16ClF3N4O2 and a molecular weight of 460.84 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 89401715 |
| Molecular Formula | C22H16ClF3N4O2 |
| Molecular Weight | 460.84 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-N'-hydroxy-3-(1H-indazol-5-yl)-5-(trifluoromethyl)benzenecarboximidamide |
| SMILES | COc1ccc(Cl)cc1-c1c(/C(N)=N/O)cc(C(F)(F)F)cc1-c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C22H16ClF3N4O2/c1-32-19-5-3-14(23)9-16(19)20-15(11-2-4-18-12(6-11)10-28-29-18)7-13(22(24,25)26)8-17(20)21(27)30-31/h2-10,31H,1H3,(H2,27,30)(H,28,29) |
| InChIKey | ZJVPVANSUPXBNB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 96.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.84 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|