C18H14ClF3N2 — CID 141327847
5-[(E)-2-[4-chloro-2-(trifluoromethyl)phenyl]but-1-enyl]-1H-indazole (PubChem CID 141327847) has the molecular formula C18H14ClF3N2 and a molecular weight of 350.77 g/mol. Its IUPAC name is 5-[(E)-2-[4-chloro-2-(trifluoromethyl)phenyl]but-1-enyl]-1H-indazole.
| Compound Name | 5-[(E)-2-[4-chloro-2-(trifluoromethyl)phenyl]but-1-enyl]-1H-indazole |
|---|---|
| PubChem CID | 141327847 |
| Molecular Formula | C18H14ClF3N2 |
| Molecular Weight | 350.77 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 5-[(E)-2-[4-chloro-2-(trifluoromethyl)phenyl]but-1-enyl]-1H-indazole |
| SMILES | CC/C(=C\c1ccc2[nH]ncc2c1)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C18H14ClF3N2/c1-2-12(7-11-3-6-17-13(8-11)10-23-24-17)15-5-4-14(19)9-16(15)18(20,21)22/h3-10H,2H2,1H3,(H,23,24)/b12-7+ |
| InChIKey | ZREHPTUJNIGAEJ-KPKJPENVSA-N |
| XLogP | 6.19 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.77 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|