C12H10N6S — CID 83084099
4-methylsulfanyl-6-quinoxalin-6-yl-1,3,5-triazin-2-amine (PubChem CID 83084099) has the molecular formula C12H10N6S and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-methylsulfanyl-6-quinoxalin-6-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-methylsulfanyl-6-quinoxalin-6-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83084099 |
| Molecular Formula | C12H10N6S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-methylsulfanyl-6-quinoxalin-6-yl-1,3,5-triazin-2-amine |
| SMILES | CSc1nc(N)nc(-c2ccc3nccnc3c2)n1 |
| InChI | InChI=1S/C12H10N6S/c1-19-12-17-10(16-11(13)18-12)7-2-3-8-9(6-7)15-5-4-14-8/h2-6H,1H3,(H2,13,16,17,18) |
| InChIKey | GVPNQTAVBYODRO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |