C8H7IN4S2 — CID 83084704
4-(5-iodothiophen-3-yl)-6-methylsulfanyl-1,3,5-triazin-2-amine (PubChem CID 83084704) has the molecular formula C8H7IN4S2 and a molecular weight of 350.21 g/mol. Its IUPAC name is 4-(5-iodothiophen-3-yl)-6-methylsulfanyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(5-iodothiophen-3-yl)-6-methylsulfanyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83084704 |
| Molecular Formula | C8H7IN4S2 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.92 |
| IUPAC Name | 4-(5-iodothiophen-3-yl)-6-methylsulfanyl-1,3,5-triazin-2-amine |
| SMILES | CSc1nc(N)nc(-c2csc(I)c2)n1 |
| InChI | InChI=1S/C8H7IN4S2/c1-14-8-12-6(11-7(10)13-8)4-2-5(9)15-3-4/h2-3H,1H3,(H2,10,11,12,13) |
| InChIKey | BOIDNCHTCMZLJV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|