C20H12BrN5 — CID 154604788
3-(6-amino-5-bromo-3-quinolin-6-ylpyrazin-2-yl)benzonitrile (PubChem CID 154604788) has the molecular formula C20H12BrN5 and a molecular weight of 402.26 g/mol. Its IUPAC name is 3-(6-amino-5-bromo-3-quinolin-6-ylpyrazin-2-yl)benzonitrile.
| Compound Name | 3-(6-amino-5-bromo-3-quinolin-6-ylpyrazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 154604788 |
| Molecular Formula | C20H12BrN5 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 3-(6-amino-5-bromo-3-quinolin-6-ylpyrazin-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(-c2nc(N)c(Br)nc2-c2ccc3ncccc3c2)c1 |
| InChI | InChI=1S/C20H12BrN5/c21-19-20(23)26-18(14-4-1-3-12(9-14)11-22)17(25-19)15-6-7-16-13(10-15)5-2-8-24-16/h1-10H,(H2,23,26) |
| InChIKey | QKZFURCQGIRHNF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |