C48H30N6 — CID 146986585
3-[3-[4-[2,6-bis(4-pyridin-2-ylphenyl)-4-pyridinyl]phenyl]quinoxalin-2-yl]benzonitrile (PubChem CID 146986585) has the molecular formula C48H30N6 and a molecular weight of 690.81 g/mol. Its IUPAC name is 3-[3-[4-[2,6-bis(4-pyridin-2-ylphenyl)-4-pyridinyl]phenyl]quinoxalin-2-yl]benzonitrile.
| Compound Name | 3-[3-[4-[2,6-bis(4-pyridin-2-ylphenyl)-4-pyridinyl]phenyl]quinoxalin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 146986585 |
| Molecular Formula | C48H30N6 |
| Molecular Weight | 690.81 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | 3-[3-[4-[2,6-bis(4-pyridin-2-ylphenyl)-4-pyridinyl]phenyl]quinoxalin-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2nc3ccccc3nc2-c2ccc(-c3cc(-c4ccc(-c5ccccn5)cc4)nc(-c4ccc(-c5ccccn5)cc4)c3)cc2)c1 |
| InChI | InChI=1S/C48H30N6/c49-31-32-8-7-9-39(28-32)48-47(53-43-12-1-2-13-44(43)54-48)38-24-14-33(15-25-38)40-29-45(36-20-16-34(17-21-36)41-10-3-5-26-50-41)52-46(30-40)37-22-18-35(19-23-37)42-11-4-6-27-51-42/h1-30H |
| InChIKey | APJHZUUYICMSGI-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.81 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |