C49H31N5 — CID 153355034
4-[4-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]quinoxalin-2-yl]phenyl]benzonitrile (PubChem CID 153355034) has the molecular formula C49H31N5 and a molecular weight of 689.82 g/mol. Its IUPAC name is 4-[4-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]quinoxalin-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]quinoxalin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 153355034 |
| Molecular Formula | C49H31N5 |
| Molecular Weight | 689.82 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | 4-[4-[3-[4,6-bis(4-phenylphenyl)pyrimidin-2-yl]quinoxalin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3nc4ccccc4nc3-c3nc(-c4ccc(-c5ccccc5)cc4)cc(-c4ccc(-c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C49H31N5/c50-32-33-15-17-36(18-16-33)39-23-29-42(30-24-39)47-48(52-44-14-8-7-13-43(44)51-47)49-53-45(40-25-19-37(20-26-40)34-9-3-1-4-10-34)31-46(54-49)41-27-21-38(22-28-41)35-11-5-2-6-12-35/h1-31H |
| InChIKey | SVXBNHLLPRTIPL-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.82 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |