C31H19N5 — CID 153355113
3-[3-(2,6-diphenylpyrimidin-4-yl)quinoxalin-2-yl]benzonitrile (PubChem CID 153355113) has the molecular formula C31H19N5 and a molecular weight of 461.53 g/mol. Its IUPAC name is 3-[3-(2,6-diphenylpyrimidin-4-yl)quinoxalin-2-yl]benzonitrile.
| Compound Name | 3-[3-(2,6-diphenylpyrimidin-4-yl)quinoxalin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 153355113 |
| Molecular Formula | C31H19N5 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3-[3-(2,6-diphenylpyrimidin-4-yl)quinoxalin-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2nc3ccccc3nc2-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C31H19N5/c32-20-21-10-9-15-24(18-21)29-30(34-26-17-8-7-16-25(26)33-29)28-19-27(22-11-3-1-4-12-22)35-31(36-28)23-13-5-2-6-14-23/h1-19H |
| InChIKey | VMTVGNNDXDNZNL-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |