C43H27N5 — CID 146914119
3-[3-[3-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]quinoxalin-2-yl]phenyl]benzonitrile (PubChem CID 146914119) has the molecular formula C43H27N5 and a molecular weight of 613.72 g/mol. Its IUPAC name is 3-[3-[3-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]quinoxalin-2-yl]phenyl]benzonitrile.
| Compound Name | 3-[3-[3-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]quinoxalin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 146914119 |
| Molecular Formula | C43H27N5 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 3-[3-[3-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]quinoxalin-2-yl]phenyl]benzonitrile |
| SMILES | N#Cc1cccc(-c2cccc(-c3nc4ccccc4nc3-c3ccc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)c2)c1 |
| InChI | InChI=1S/C43H27N5/c44-28-29-11-9-16-34(25-29)35-17-10-18-36(26-35)42-41(45-37-19-7-8-20-38(37)46-42)32-21-23-33(24-22-32)43-47-39(30-12-3-1-4-13-30)27-40(48-43)31-14-5-2-6-15-31/h1-27H |
| InChIKey | ABWOESJNYUYTAR-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |