C22H15ClN2 — CID 45354718
4-(4-phenylquinolin-2-yl)benzonitrile;hydrochloride (PubChem CID 45354718) has the molecular formula C22H15ClN2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 4-(4-phenylquinolin-2-yl)benzonitrile;hydrochloride.
| Compound Name | 4-(4-phenylquinolin-2-yl)benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 45354718 |
| Molecular Formula | C22H15ClN2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-(4-phenylquinolin-2-yl)benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc(-c2cc(-c3ccccc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C22H14N2.ClH/c23-15-16-10-12-18(13-11-16)22-14-20(17-6-2-1-3-7-17)19-8-4-5-9-21(19)24-22;/h1-14H;1H |
| InChIKey | URGQPAZNCZHAOA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |