About quinolin-6-yl formate
quinolin-6-yl formate (PubChem CID 57289431) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is quinolin-6-yl formate.
Molecular Properties
| Compound Name | quinolin-6-yl formate |
| PubChem CID | 57289431 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | quinolin-6-yl formate |
| SMILES | O=COc1ccc2ncccc2c1 |
| InChI | InChI=1S/C10H7NO2/c12-7-13-9-3-4-10-8(6-9)2-1-5-11-10/h1-7H |
| InChIKey | YYGABBKEHFTTOT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze quinolin-6-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-6-yl formate?
The IUPAC name of quinolin-6-yl formate (CID 57289431) is quinolin-6-yl formate.
What is the SMILES notation for quinolin-6-yl formate?
The canonical SMILES for quinolin-6-yl formate is O=COc1ccc2ncccc2c1.
What is the InChIKey of quinolin-6-yl formate?
The InChIKey is YYGABBKEHFTTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c12-7-13-9-3-4-10-8(6-9)2-1-5-11-10/h1-7H.
What are the key properties of quinolin-6-yl formate?
quinolin-6-yl formate has a molecular weight of 173.17 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-6-yl formate is sourced from PubChem (CID 57289431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).