About phenanthridin-2-yl methanesulfonate
phenanthridin-2-yl methanesulfonate (PubChem CID 154457207) has the molecular formula C14H11NO3S
and a molecular weight of 273.31 g/mol. Its IUPAC name is phenanthridin-2-yl methanesulfonate.
Molecular Properties
| Compound Name | phenanthridin-2-yl methanesulfonate |
| PubChem CID | 154457207 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | phenanthridin-2-yl methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2ncc3ccccc3c2c1 |
| InChI | InChI=1S/C14H11NO3S/c1-19(16,17)18-11-6-7-14-13(8-11)12-5-3-2-4-10(12)9-15-14/h2-9H,1H3 |
| InChIKey | JGQPCXXGIYPXQL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze phenanthridin-2-yl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthridin-2-yl methanesulfonate?
The IUPAC name of phenanthridin-2-yl methanesulfonate (CID 154457207) is phenanthridin-2-yl methanesulfonate.
What is the SMILES notation for phenanthridin-2-yl methanesulfonate?
The canonical SMILES for phenanthridin-2-yl methanesulfonate is CS(=O)(=O)Oc1ccc2ncc3ccccc3c2c1.
What is the InChIKey of phenanthridin-2-yl methanesulfonate?
The InChIKey is JGQPCXXGIYPXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3S/c1-19(16,17)18-11-6-7-14-13(8-11)12-5-3-2-4-10(12)9-15-14/h2-9H,1H3.
What are the key properties of phenanthridin-2-yl methanesulfonate?
phenanthridin-2-yl methanesulfonate has a molecular weight of 273.31 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthridin-2-yl methanesulfonate is sourced from PubChem (CID 154457207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).