C18H19N3O2S — CID 19826040
2-(1,4-diazepan-1-ylsulfonyl)phenanthridine (PubChem CID 19826040) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-ylsulfonyl)phenanthridine.
| Compound Name | 2-(1,4-diazepan-1-ylsulfonyl)phenanthridine |
|---|---|
| PubChem CID | 19826040 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-(1,4-diazepan-1-ylsulfonyl)phenanthridine |
| SMILES | O=S(=O)(c1ccc2ncc3ccccc3c2c1)N1CCCNCC1 |
| InChI | InChI=1S/C18H19N3O2S/c22-24(23,21-10-3-8-19-9-11-21)15-6-7-18-17(12-15)16-5-2-1-4-14(16)13-20-18/h1-2,4-7,12-13,19H,3,8-11H2 |
| InChIKey | FOCKMWHZDOXZSE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|