About (6-aminonaphthalen-2-yl) methanesulfonate
(6-aminonaphthalen-2-yl) methanesulfonate (PubChem CID 54353841) has the molecular formula C11H11NO3S
and a molecular weight of 237.28 g/mol. Its IUPAC name is (6-aminonaphthalen-2-yl) methanesulfonate.
Molecular Properties
| Compound Name | (6-aminonaphthalen-2-yl) methanesulfonate |
| PubChem CID | 54353841 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | (6-aminonaphthalen-2-yl) methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2cc(N)ccc2c1 |
| InChI | InChI=1S/C11H11NO3S/c1-16(13,14)15-11-5-3-8-6-10(12)4-2-9(8)7-11/h2-7H,12H2,1H3 |
| InChIKey | UHRXINKIUBEOBK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (6-aminonaphthalen-2-yl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-aminonaphthalen-2-yl) methanesulfonate?
The IUPAC name of (6-aminonaphthalen-2-yl) methanesulfonate (CID 54353841) is (6-aminonaphthalen-2-yl) methanesulfonate.
What is the SMILES notation for (6-aminonaphthalen-2-yl) methanesulfonate?
The canonical SMILES for (6-aminonaphthalen-2-yl) methanesulfonate is CS(=O)(=O)Oc1ccc2cc(N)ccc2c1.
What is the InChIKey of (6-aminonaphthalen-2-yl) methanesulfonate?
The InChIKey is UHRXINKIUBEOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c1-16(13,14)15-11-5-3-8-6-10(12)4-2-9(8)7-11/h2-7H,12H2,1H3.
What are the key properties of (6-aminonaphthalen-2-yl) methanesulfonate?
(6-aminonaphthalen-2-yl) methanesulfonate has a molecular weight of 237.28 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-aminonaphthalen-2-yl) methanesulfonate is sourced from PubChem (CID 54353841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).